C21H16ClN5O3 — CID 66538790
2-chloro-4-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid (PubChem CID 66538790) has the molecular formula C21H16ClN5O3 and a molecular weight of 421.84 g/mol. Its IUPAC name is 2-chloro-4-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 66538790 |
| Molecular Formula | C21H16ClN5O3 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-chloro-4-[[4-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc(Oc3nnnn3-c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C21H16ClN5O3/c22-19-12-15(8-11-18(19)20(28)29)23-13-14-6-9-17(10-7-14)30-21-24-25-26-27(21)16-4-2-1-3-5-16/h1-12,23H,13H2,(H,28,29) |
| InChIKey | CVHJORZIUPVYLC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |