C25H25ClN6O2 — CID 17206368
2-(1H-indol-3-yl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride (PubChem CID 17206368) has the molecular formula C25H25ClN6O2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1H-indol-3-yl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17206368 |
| Molecular Formula | C25H25ClN6O2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[[3-methoxy-4-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride |
| SMILES | COc1cc(CNCCc2c[nH]c3ccccc23)ccc1Oc1nnnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C25H24N6O2.ClH/c1-32-24-15-18(16-26-14-13-19-17-27-22-10-6-5-9-21(19)22)11-12-23(24)33-25-28-29-30-31(25)20-7-3-2-4-8-20;/h2-12,15,17,26-27H,13-14,16H2,1H3;1H |
| InChIKey | LSLLHCAMQXFBJQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|