C22H32ClNO2 — CID 17293936
N-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride (PubChem CID 17293936) has the molecular formula C22H32ClNO2 and a molecular weight of 377.96 g/mol. Its IUPAC name is N-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17293936 |
| Molecular Formula | C22H32ClNO2 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCCCNCc1ccc(OCc2ccc(C)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C22H31NO2.ClH/c1-4-5-6-7-14-23-16-20-12-13-21(22(15-20)24-3)25-17-19-10-8-18(2)9-11-19;/h8-13,15,23H,4-7,14,16-17H2,1-3H3;1H |
| InChIKey | FDLIKNXXFMNEQW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|