C20H24ClN5O2 — CID 17333359
N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17333359) has the molecular formula C20H24ClN5O2 and a molecular weight of 401.90 g/mol. Its IUPAC name is N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333359 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[[3-methoxy-4-[[1-(4-methylphenyl)tetrazol-5-yl]methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1ccc(OCc2nnnn2-c2ccc(C)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C20H23N5O2.ClH/c1-4-11-21-13-16-7-10-18(19(12-16)26-3)27-14-20-22-23-24-25(20)17-8-5-15(2)6-9-17;/h4-10,12,21H,1,11,13-14H2,2-3H3;1H |
| InChIKey | XTBNFJIWDGCSSK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|