C12H16FN5 — CID 62735534
N-[[1-(5-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 62735534) has the molecular formula C12H16FN5 and a molecular weight of 249.29 g/mol. Its IUPAC name is N-[[1-(5-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(5-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62735534 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[[1-(5-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnnn1-c1cc(F)ccc1C |
| InChI | InChI=1S/C12H16FN5/c1-3-6-14-8-12-15-16-17-18(12)11-7-10(13)5-4-9(11)2/h4-5,7,14H,3,6,8H2,1-2H3 |
| InChIKey | HEYNNZXOUBUMBY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|