C11H13BrFN5O — CID 107639463
N-[[1-(2-bromo-5-fluorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 107639463) has the molecular formula C11H13BrFN5O and a molecular weight of 330.16 g/mol. Its IUPAC name is N-[[1-(2-bromo-5-fluorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(2-bromo-5-fluorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107639463 |
| Molecular Formula | C11H13BrFN5O |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-[[1-(2-bromo-5-fluorophenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnnn1-c1cc(F)ccc1Br |
| InChI | InChI=1S/C11H13BrFN5O/c1-19-5-4-14-7-11-15-16-17-18(11)10-6-8(13)2-3-9(10)12/h2-3,6,14H,4-5,7H2,1H3 |
| InChIKey | ORXHMXADDDFUED-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|