C13H18BrN5O — CID 65499863
N-[[1-(4-bromo-2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 65499863) has the molecular formula C13H18BrN5O and a molecular weight of 340.23 g/mol. Its IUPAC name is N-[[1-(4-bromo-2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(4-bromo-2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65499863 |
| Molecular Formula | C13H18BrN5O |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[[1-(4-bromo-2,6-dimethylphenyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnnn1-c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C13H18BrN5O/c1-9-6-11(14)7-10(2)13(9)19-12(16-17-18-19)8-15-4-5-20-3/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | AYIRFIGTPFCWNG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|