C12H14N6OS — CID 107806576
N-[[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 107806576) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107806576 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnnn1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H14N6OS/c1-19-5-4-13-7-12-15-16-17-18(12)9-2-3-10-11(6-9)20-8-14-10/h2-3,6,8,13H,4-5,7H2,1H3 |
| InChIKey | YJUSCPICFGPCGG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|