C14H10N6S — CID 107806544
2-[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]aniline (PubChem CID 107806544) has the molecular formula C14H10N6S and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]aniline.
| Compound Name | 2-[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107806544 |
| Molecular Formula | C14H10N6S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[1-(1,3-benzothiazol-6-yl)tetrazol-5-yl]aniline |
| SMILES | Nc1ccccc1-c1nnnn1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H10N6S/c15-11-4-2-1-3-10(11)14-17-18-19-20(14)9-5-6-12-13(7-9)21-8-16-12/h1-8H,15H2 |
| InChIKey | PMHPMKGHJIXDLG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|