C13H18FN5O — CID 62737032
N-[[1-(3-fluoro-4-methoxyphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62737032) has the molecular formula C13H18FN5O and a molecular weight of 279.32 g/mol. Its IUPAC name is N-[[1-(3-fluoro-4-methoxyphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(3-fluoro-4-methoxyphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62737032 |
| Molecular Formula | C13H18FN5O |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[[1-(3-fluoro-4-methoxyphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine |
| SMILES | COc1ccc(-n2nnnc2CNCC(C)C)cc1F |
| InChI | InChI=1S/C13H18FN5O/c1-9(2)7-15-8-13-16-17-18-19(13)10-4-5-12(20-3)11(14)6-10/h4-6,9,15H,7-8H2,1-3H3 |
| InChIKey | JSQNYDKXBWJLOI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |