C13H18FN5 — CID 55109541
N-[[1-(3-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine (PubChem CID 55109541) has the molecular formula C13H18FN5 and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[[1-(3-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(3-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 55109541 |
| Molecular Formula | C13H18FN5 |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[[1-(3-fluoro-2-methylphenyl)tetrazol-5-yl]methyl]-2-methylpropan-1-amine |
| SMILES | Cc1c(F)cccc1-n1nnnc1CNCC(C)C |
| InChI | InChI=1S/C13H18FN5/c1-9(2)7-15-8-13-16-17-18-19(13)12-6-4-5-11(14)10(12)3/h4-6,9,15H,7-8H2,1-3H3 |
| InChIKey | VYTGYDKKWBGVPJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |