C15H11ClF3N5 — CID 51225137
4-chloro-N-[(1-phenyltetrazol-5-yl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 51225137) has the molecular formula C15H11ClF3N5 and a molecular weight of 353.74 g/mol. Its IUPAC name is 4-chloro-N-[(1-phenyltetrazol-5-yl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-[(1-phenyltetrazol-5-yl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 51225137 |
| Molecular Formula | C15H11ClF3N5 |
| Molecular Weight | 353.74 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-chloro-N-[(1-phenyltetrazol-5-yl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NCc2nnnn2-c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C15H11ClF3N5/c16-13-7-6-10(8-12(13)15(17,18)19)20-9-14-21-22-23-24(14)11-4-2-1-3-5-11/h1-8,20H,9H2 |
| InChIKey | WDGFFLBJXKVPEG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |