C12H12ClF3N4O — CID 66269599
2-[4-[[4-chloro-3-(trifluoromethyl)anilino]methyl]triazol-1-yl]ethanol (PubChem CID 66269599) has the molecular formula C12H12ClF3N4O and a molecular weight of 320.70 g/mol. Its IUPAC name is 2-[4-[[4-chloro-3-(trifluoromethyl)anilino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[4-chloro-3-(trifluoromethyl)anilino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66269599 |
| Molecular Formula | C12H12ClF3N4O |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[4-[[4-chloro-3-(trifluoromethyl)anilino]methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2ccc(Cl)c(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C12H12ClF3N4O/c13-11-2-1-8(5-10(11)12(14,15)16)17-6-9-7-20(3-4-21)19-18-9/h1-2,5,7,17,21H,3-4,6H2 |
| InChIKey | HETDQTAVXVSAMC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |