C12H14N6O2 — CID 66270727
5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 66270727) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 66270727 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(NCc3cn(CCO)nn3)cc2[nH]1 |
| InChI | InChI=1S/C12H14N6O2/c19-4-3-18-7-9(16-17-18)6-13-8-1-2-10-11(5-8)15-12(20)14-10/h1-2,5,7,13,19H,3-4,6H2,(H2,14,15,20) |
| InChIKey | CVCDDSQXEDRSMC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|