C11H12F2N4O — CID 66269403
2-[4-[(3,5-difluoroanilino)methyl]triazol-1-yl]ethanol (PubChem CID 66269403) has the molecular formula C11H12F2N4O and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-[4-[(3,5-difluoroanilino)methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[(3,5-difluoroanilino)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66269403 |
| Molecular Formula | C11H12F2N4O |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-[4-[(3,5-difluoroanilino)methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2cc(F)cc(F)c2)nn1 |
| InChI | InChI=1S/C11H12F2N4O/c12-8-3-9(13)5-10(4-8)14-6-11-7-17(1-2-18)16-15-11/h3-5,7,14,18H,1-2,6H2 |
| InChIKey | FMKPKXAAWDEBEG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |