C11H9F5N4O — CID 115564130
2-[4-[(2,3,4,5,6-pentafluoroanilino)methyl]triazol-1-yl]ethanol (PubChem CID 115564130) has the molecular formula C11H9F5N4O and a molecular weight of 308.21 g/mol. Its IUPAC name is 2-[4-[(2,3,4,5,6-pentafluoroanilino)methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[(2,3,4,5,6-pentafluoroanilino)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 115564130 |
| Molecular Formula | C11H9F5N4O |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[4-[(2,3,4,5,6-pentafluoroanilino)methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2c(F)c(F)c(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C11H9F5N4O/c12-6-7(13)9(15)11(10(16)8(6)14)17-3-5-4-20(1-2-21)19-18-5/h4,17,21H,1-3H2 |
| InChIKey | OMODAYQFYJNFFG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|