C11H13FN4O — CID 66268072
2-[4-[(4-fluoroanilino)methyl]triazol-1-yl]ethanol (PubChem CID 66268072) has the molecular formula C11H13FN4O and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[4-[(4-fluoroanilino)methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[(4-fluoroanilino)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66268072 |
| Molecular Formula | C11H13FN4O |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-[4-[(4-fluoroanilino)methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C11H13FN4O/c12-9-1-3-10(4-2-9)13-7-11-8-16(5-6-17)15-14-11/h1-4,8,13,17H,5-7H2 |
| InChIKey | OUQUYXXVCGIJRN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |