C13H13N5O3 — CID 66270351
5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]isoindole-1,3-dione (PubChem CID 66270351) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]isoindole-1,3-dione.
| Compound Name | 5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 66270351 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(NCc3cn(CCO)nn3)ccc21 |
| InChI | InChI=1S/C13H13N5O3/c19-4-3-18-7-9(16-17-18)6-14-8-1-2-10-11(5-8)13(21)15-12(10)20/h1-2,5,7,14,19H,3-4,6H2,(H,15,20,21) |
| InChIKey | NQOGSVOOPXMURX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|