C11H11BrF2N4O — CID 66270971
2-[4-[(4-bromo-2,6-difluoroanilino)methyl]triazol-1-yl]ethanol (PubChem CID 66270971) has the molecular formula C11H11BrF2N4O and a molecular weight of 333.14 g/mol. Its IUPAC name is 2-[4-[(4-bromo-2,6-difluoroanilino)methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[(4-bromo-2,6-difluoroanilino)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66270971 |
| Molecular Formula | C11H11BrF2N4O |
| Molecular Weight | 333.14 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-[4-[(4-bromo-2,6-difluoroanilino)methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2c(F)cc(Br)cc2F)nn1 |
| InChI | InChI=1S/C11H11BrF2N4O/c12-7-3-9(13)11(10(14)4-7)15-5-8-6-18(1-2-19)17-16-8/h3-4,6,15,19H,1-2,5H2 |
| InChIKey | MTVQGPKMWVCTGD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |