C17H13F3N6O — CID 47063931
5-[(1-phenyltetrazol-5-yl)methylamino]-2-(2,2,2-trifluoroethoxy)benzonitrile (PubChem CID 47063931) has the molecular formula C17H13F3N6O and a molecular weight of 374.33 g/mol. Its IUPAC name is 5-[(1-phenyltetrazol-5-yl)methylamino]-2-(2,2,2-trifluoroethoxy)benzonitrile.
| Compound Name | 5-[(1-phenyltetrazol-5-yl)methylamino]-2-(2,2,2-trifluoroethoxy)benzonitrile |
|---|---|
| PubChem CID | 47063931 |
| Molecular Formula | C17H13F3N6O |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 5-[(1-phenyltetrazol-5-yl)methylamino]-2-(2,2,2-trifluoroethoxy)benzonitrile |
| SMILES | N#Cc1cc(NCc2nnnn2-c2ccccc2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H13F3N6O/c18-17(19,20)11-27-15-7-6-13(8-12(15)9-21)22-10-16-23-24-25-26(16)14-4-2-1-3-5-14/h1-8,22H,10-11H2 |
| InChIKey | BDAKKMNHPRVPII-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|