C12H9F3N4OS — CID 91652132
5-(thiadiazol-4-ylmethylamino)-2-(2,2,2-trifluoroethoxy)benzonitrile (PubChem CID 91652132) has the molecular formula C12H9F3N4OS and a molecular weight of 314.29 g/mol. Its IUPAC name is 5-(thiadiazol-4-ylmethylamino)-2-(2,2,2-trifluoroethoxy)benzonitrile.
| Compound Name | 5-(thiadiazol-4-ylmethylamino)-2-(2,2,2-trifluoroethoxy)benzonitrile |
|---|---|
| PubChem CID | 91652132 |
| Molecular Formula | C12H9F3N4OS |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-(thiadiazol-4-ylmethylamino)-2-(2,2,2-trifluoroethoxy)benzonitrile |
| SMILES | N#Cc1cc(NCc2csnn2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C12H9F3N4OS/c13-12(14,15)7-20-11-2-1-9(3-8(11)4-16)17-5-10-6-21-19-18-10/h1-3,6,17H,5,7H2 |
| InChIKey | WKJQGKWRDRTTHA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|