C14H14F3N3O2 — CID 51088495
2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-cyclopropylacetamide (PubChem CID 51088495) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-cyclopropylacetamide.
| Compound Name | 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 51088495 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[3-cyano-4-(2,2,2-trifluoroethoxy)anilino]-N-cyclopropylacetamide |
| SMILES | N#Cc1cc(NCC(=O)NC2CC2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O2/c15-14(16,17)8-22-12-4-3-11(5-9(12)6-18)19-7-13(21)20-10-1-2-10/h3-5,10,19H,1-2,7-8H2,(H,20,21) |
| InChIKey | JYTQAEJBAUNQDO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|