C16H22N2O3 — CID 22228170
4-[3-cyano-4-(2,2-dimethylpropoxy)anilino]butanoic acid (PubChem CID 22228170) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-[3-cyano-4-(2,2-dimethylpropoxy)anilino]butanoic acid.
| Compound Name | 4-[3-cyano-4-(2,2-dimethylpropoxy)anilino]butanoic acid |
|---|---|
| PubChem CID | 22228170 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-[3-cyano-4-(2,2-dimethylpropoxy)anilino]butanoic acid |
| SMILES | CC(C)(C)COc1ccc(NCCCC(=O)O)cc1C#N |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)11-21-14-7-6-13(9-12(14)10-17)18-8-4-5-15(19)20/h6-7,9,18H,4-5,8,11H2,1-3H3,(H,19,20) |
| InChIKey | YTCITURWNUIKNN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|