C16H22N2O2 — CID 81274513
6-(4-cyano-3-methylanilino)-4,4-dimethylhexanoic acid (PubChem CID 81274513) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-(4-cyano-3-methylanilino)-4,4-dimethylhexanoic acid.
| Compound Name | 6-(4-cyano-3-methylanilino)-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 81274513 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 6-(4-cyano-3-methylanilino)-4,4-dimethylhexanoic acid |
| SMILES | Cc1cc(NCCC(C)(C)CCC(=O)O)ccc1C#N |
| InChI | InChI=1S/C16H22N2O2/c1-12-10-14(5-4-13(12)11-17)18-9-8-16(2,3)7-6-15(19)20/h4-5,10,18H,6-9H2,1-3H3,(H,19,20) |
| InChIKey | IENZPTCPKLZMKH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |