C13H18N4O — CID 83111545
3-[2-(4-cyano-3-methylanilino)ethyl]-1,1-dimethylurea (PubChem CID 83111545) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-[2-(4-cyano-3-methylanilino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4-cyano-3-methylanilino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83111545 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-[2-(4-cyano-3-methylanilino)ethyl]-1,1-dimethylurea |
| SMILES | Cc1cc(NCCNC(=O)N(C)C)ccc1C#N |
| InChI | InChI=1S/C13H18N4O/c1-10-8-12(5-4-11(10)9-14)15-6-7-16-13(18)17(2)3/h4-5,8,15H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | CXBRBNCAJWVKMW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|