C11H17N3O — CID 142040993
3-(2-anilinoethyl)-1,1-dimethylurea (PubChem CID 142040993) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-(2-anilinoethyl)-1,1-dimethylurea.
| Compound Name | 3-(2-anilinoethyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 142040993 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-(2-anilinoethyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccccc1 |
| InChI | InChI=1S/C11H17N3O/c1-14(2)11(15)13-9-8-12-10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3,(H,13,15) |
| InChIKey | LQFREETWJIEIBE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|