C11H16N2O — CID 60961994
3-anilino-N,N-dimethylpropanamide (PubChem CID 60961994) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-anilino-N,N-dimethylpropanamide.
| Compound Name | 3-anilino-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60961994 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-anilino-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNc1ccccc1 |
| InChI | InChI=1S/C11H16N2O/c1-13(2)11(14)8-9-12-10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3 |
| InChIKey | PXFJKTICJZHLNW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |