C13H21N3O3S — CID 60926501
3-[4-(dimethylsulfamoyl)anilino]-N,N-dimethylpropanamide (PubChem CID 60926501) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-[4-(dimethylsulfamoyl)anilino]-N,N-dimethylpropanamide.
| Compound Name | 3-[4-(dimethylsulfamoyl)anilino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60926501 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-[4-(dimethylsulfamoyl)anilino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H21N3O3S/c1-15(2)13(17)9-10-14-11-5-7-12(8-6-11)20(18,19)16(3)4/h5-8,14H,9-10H2,1-4H3 |
| InChIKey | QUZGVPIREQDOGO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |