C10H17N5O — CID 83116884
3-[2-[(6-amino-3-pyridinyl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83116884) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-[2-[(6-amino-3-pyridinyl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(6-amino-3-pyridinyl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116884 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-[2-[(6-amino-3-pyridinyl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccc(N)nc1 |
| InChI | InChI=1S/C10H17N5O/c1-15(2)10(16)13-6-5-12-8-3-4-9(11)14-7-8/h3-4,7,12H,5-6H2,1-2H3,(H2,11,14)(H,13,16) |
| InChIKey | CVIYPGYZUSDRKS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|