C11H18N6O2 — CID 113436386
N-[2-(dimethylcarbamoylamino)ethyl]-5-hydrazinylpyridine-2-carboxamide (PubChem CID 113436386) has the molecular formula C11H18N6O2 and a molecular weight of 266.31 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoylamino)ethyl]-5-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-[2-(dimethylcarbamoylamino)ethyl]-5-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 113436386 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[2-(dimethylcarbamoylamino)ethyl]-5-hydrazinylpyridine-2-carboxamide |
| SMILES | CN(C)C(=O)NCCNC(=O)c1ccc(NN)cn1 |
| InChI | InChI=1S/C11H18N6O2/c1-17(2)11(19)14-6-5-13-10(18)9-4-3-8(16-12)7-15-9/h3-4,7,16H,5-6,12H2,1-2H3,(H,13,18)(H,14,19) |
| InChIKey | VHHZCMACTOZAPP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|