C10H13F3N4O2 — CID 104642797
5-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2-carboxamide (PubChem CID 104642797) has the molecular formula C10H13F3N4O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is 5-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104642797 |
| Molecular Formula | C10H13F3N4O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2-carboxamide |
| SMILES | NNc1ccc(C(=O)NCCOCC(F)(F)F)nc1 |
| InChI | InChI=1S/C10H13F3N4O2/c11-10(12,13)6-19-4-3-15-9(18)8-2-1-7(17-14)5-16-8/h1-2,5,17H,3-4,6,14H2,(H,15,18) |
| InChIKey | WFOJIEGSSNAMQK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|