C12H13F3N2O4 — CID 63834438
2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyridine-3-carboxylic acid (PubChem CID 63834438) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63834438 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyridine-3-carboxylic acid |
| SMILES | Cc1nc(C(=O)NCCOCC(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C12H13F3N2O4/c1-7-8(11(19)20)2-3-9(17-7)10(18)16-4-5-21-6-12(13,14)15/h2-3H,4-6H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | QZWNTUZTHFTMKI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|