C11H13F3N2O3 — CID 103717467
6-methyl-4-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide (PubChem CID 103717467) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103717467 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 6-methyl-4-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCOCC(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C11H13F3N2O3/c1-7-4-9(17)8(5-16-7)10(18)15-2-3-19-6-11(12,13)14/h4-5H,2-3,6H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | LOUXRDAGGZRRGF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|