C12H18N2O3 — CID 104578609
6-methyl-4-oxo-N-(2-propan-2-yloxyethyl)-1H-pyridine-3-carboxamide (PubChem CID 104578609) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-(2-propan-2-yloxyethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-(2-propan-2-yloxyethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 104578609 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6-methyl-4-oxo-N-(2-propan-2-yloxyethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCOC(C)C)c[nH]1 |
| InChI | InChI=1S/C12H18N2O3/c1-8(2)17-5-4-13-12(16)10-7-14-9(3)6-11(10)15/h6-8H,4-5H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | NVHQXAUEGUKAPP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|