C10H12BrF3N4O2 — CID 63832210
5-bromo-2-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide (PubChem CID 63832210) has the molecular formula C10H12BrF3N4O2 and a molecular weight of 357.13 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63832210 |
| Molecular Formula | C10H12BrF3N4O2 |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-3-carboxamide |
| SMILES | NNc1ncc(Br)cc1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N4O2/c11-6-3-7(8(18-15)17-4-6)9(19)16-1-2-20-5-10(12,13)14/h3-4H,1-2,5,15H2,(H,16,19)(H,17,18) |
| InChIKey | XPMRQLAPSPHKHJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|