C13H20BrN3O2 — CID 55047105
5-bromo-N-(2-butoxyethyl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 55047105) has the molecular formula C13H20BrN3O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 5-bromo-N-(2-butoxyethyl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2-butoxyethyl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55047105 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-bromo-N-(2-butoxyethyl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CCCCOCCNC(=O)c1cc(Br)cnc1NC |
| InChI | InChI=1S/C13H20BrN3O2/c1-3-4-6-19-7-5-16-13(18)11-8-10(14)9-17-12(11)15-2/h8-9H,3-7H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | OIXILDRGGCDFAI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|