C10H15BrN4O3S — CID 55047276
5-bromo-2-(methylamino)-N-(3-sulfamoylpropyl)pyridine-3-carboxamide (PubChem CID 55047276) has the molecular formula C10H15BrN4O3S and a molecular weight of 351.23 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-(3-sulfamoylpropyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-(methylamino)-N-(3-sulfamoylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55047276 |
| Molecular Formula | C10H15BrN4O3S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-(3-sulfamoylpropyl)pyridine-3-carboxamide |
| SMILES | CNc1ncc(Br)cc1C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H15BrN4O3S/c1-13-9-8(5-7(11)6-15-9)10(16)14-3-2-4-19(12,17)18/h5-6H,2-4H2,1H3,(H,13,15)(H,14,16)(H2,12,17,18) |
| InChIKey | NUNGSZOULRZQQR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|