C10H12BrF3N4O — CID 113328075
5-bromo-2-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide (PubChem CID 113328075) has the molecular formula C10H12BrF3N4O and a molecular weight of 341.13 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113328075 |
| Molecular Formula | C10H12BrF3N4O |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-3-carboxamide |
| SMILES | NNc1ncc(Br)cc1C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N4O/c11-6-4-7(8(18-15)17-5-6)9(19)16-3-1-2-10(12,13)14/h4-5H,1-3,15H2,(H,16,19)(H,17,18) |
| InChIKey | CGRLNLOVCJOJOF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|