C13H20BrN5O2 — CID 62242574
5-bromo-N-[3-(butan-2-ylamino)-3-oxopropyl]-2-hydrazinylpyridine-3-carboxamide (PubChem CID 62242574) has the molecular formula C13H20BrN5O2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 5-bromo-N-[3-(butan-2-ylamino)-3-oxopropyl]-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[3-(butan-2-ylamino)-3-oxopropyl]-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62242574 |
| Molecular Formula | C13H20BrN5O2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 5-bromo-N-[3-(butan-2-ylamino)-3-oxopropyl]-2-hydrazinylpyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)c1cc(Br)cnc1NN |
| InChI | InChI=1S/C13H20BrN5O2/c1-3-8(2)18-11(20)4-5-16-13(21)10-6-9(14)7-17-12(10)19-15/h6-8H,3-5,15H2,1-2H3,(H,16,21)(H,17,19)(H,18,20) |
| InChIKey | QMZCPPLRWBRBBH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|