C11H15F3N4O2 — CID 107375742
5-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazine-2-carboxamide (PubChem CID 107375742) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 5-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107375742 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-(ethylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)NCCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H15F3N4O2/c1-2-15-9-6-17-8(5-18-9)10(19)16-3-4-20-7-11(12,13)14/h5-6H,2-4,7H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | ZLPDAWMGMBRNNK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|