C13H20F3N3O2 — CID 87012608
3-tert-butyl-1-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-5-carboxamide (PubChem CID 87012608) has the molecular formula C13H20F3N3O2 and a molecular weight of 307.32 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-5-carboxamide.
| Compound Name | 3-tert-butyl-1-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 87012608 |
| Molecular Formula | C13H20F3N3O2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-tert-butyl-1-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O2/c1-12(2,3)10-7-9(19(4)18-10)11(20)17-5-6-21-8-13(14,15)16/h7H,5-6,8H2,1-4H3,(H,17,20) |
| InChIKey | WPEQNAIPZZVFII-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|