C12H16N6O — CID 107375934
5-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 107375934) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107375934 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)NCCc2cnc[nH]2)cn1 |
| InChI | InChI=1S/C12H16N6O/c1-2-14-11-7-16-10(6-17-11)12(19)15-4-3-9-5-13-8-18-9/h5-8H,2-4H2,1H3,(H,13,18)(H,14,17)(H,15,19) |
| InChIKey | CTIMSZALMLGHSW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |