C10H16N4O — CID 104642323
N,N-diethyl-5-hydrazinylpyridine-2-carboxamide (PubChem CID 104642323) has the molecular formula C10H16N4O and a molecular weight of 208.27 g/mol. Its IUPAC name is N,N-diethyl-5-hydrazinylpyridine-2-carboxamide.
| Compound Name | N,N-diethyl-5-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 104642323 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N,N-diethyl-5-hydrazinylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NN)cn1 |
| InChI | InChI=1S/C10H16N4O/c1-3-14(4-2)10(15)9-6-5-8(13-11)7-12-9/h5-7,13H,3-4,11H2,1-2H3 |
| InChIKey | ZLPNZJIKNXFMFJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|