C10H14N2O2 — CID 67234300
N,N-diethyl-5-hydroxypyridine-2-carboxamide (PubChem CID 67234300) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N,N-diethyl-5-hydroxypyridine-2-carboxamide.
| Compound Name | N,N-diethyl-5-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 67234300 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N,N-diethyl-5-hydroxypyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(O)cn1 |
| InChI | InChI=1S/C10H14N2O2/c1-3-12(4-2)10(14)9-6-5-8(13)7-11-9/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | MUVXEBGPIARWHS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |