C10H16ClN5O — CID 114285886
3-[2-[(3-amino-5-chloro-4-pyridinyl)amino]ethyl]-1,1-dimethylurea (PubChem CID 114285886) has the molecular formula C10H16ClN5O and a molecular weight of 257.72 g/mol. Its IUPAC name is 3-[2-[(3-amino-5-chloro-4-pyridinyl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(3-amino-5-chloro-4-pyridinyl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 114285886 |
| Molecular Formula | C10H16ClN5O |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-[2-[(3-amino-5-chloro-4-pyridinyl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1c(N)cncc1Cl |
| InChI | InChI=1S/C10H16ClN5O/c1-16(2)10(17)15-4-3-14-9-7(11)5-13-6-8(9)12/h5-6H,3-4,12H2,1-2H3,(H,13,14)(H,15,17) |
| InChIKey | VUQWMYBPGGHLBF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|