C11H19N5O2 — CID 83116624
3-[2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83116624) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-[2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116624 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-[2-[(3-amino-6-methoxy-2-pyridinyl)amino]ethyl]-1,1-dimethylurea |
| SMILES | COc1ccc(N)c(NCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C11H19N5O2/c1-16(2)11(17)14-7-6-13-10-8(12)4-5-9(15-10)18-3/h4-5H,6-7,12H2,1-3H3,(H,13,15)(H,14,17) |
| InChIKey | CAICABMDMXVWBQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|