C9H12F3N3O — CID 115320787
6-methoxy-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine (PubChem CID 115320787) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 6-methoxy-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine.
| Compound Name | 6-methoxy-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115320787 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 6-methoxy-2-N-(3,3,3-trifluoropropyl)pyridine-2,3-diamine |
| SMILES | COc1ccc(N)c(NCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O/c1-16-7-3-2-6(13)8(15-7)14-5-4-9(10,11)12/h2-3H,4-5,13H2,1H3,(H,14,15) |
| InChIKey | LXJWDAGLWKVIQG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |