C7H12ClN3O — CID 22731600
6-methoxy-2-N-methylpyridine-2,3-diamine;hydrochloride (PubChem CID 22731600) has the molecular formula C7H12ClN3O and a molecular weight of 189.65 g/mol. Its IUPAC name is 6-methoxy-2-N-methylpyridine-2,3-diamine;hydrochloride.
| Compound Name | 6-methoxy-2-N-methylpyridine-2,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 22731600 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 6-methoxy-2-N-methylpyridine-2,3-diamine;hydrochloride |
| SMILES | CNc1nc(OC)ccc1N.Cl |
| InChI | InChI=1S/C7H11N3O.ClH/c1-9-7-5(8)3-4-6(10-7)11-2;/h3-4H,8H2,1-2H3,(H,9,10);1H |
| InChIKey | YAWWVJJDKDCXFV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |