C7H11N3O — CID 59159330
6-methoxy-3-N-methylpyridine-2,3-diamine (PubChem CID 59159330) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-methoxy-3-N-methylpyridine-2,3-diamine.
| Compound Name | 6-methoxy-3-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 59159330 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 6-methoxy-3-N-methylpyridine-2,3-diamine |
| SMILES | CNc1ccc(OC)nc1N |
| InChI | InChI=1S/C7H11N3O/c1-9-5-3-4-6(11-2)10-7(5)8/h3-4,9H,1-2H3,(H2,8,10) |
| InChIKey | IFCBMQHLEKIQPO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |