C9H15N3O — CID 115320271
6-methoxy-2-N-propan-2-ylpyridine-2,3-diamine (PubChem CID 115320271) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-methoxy-2-N-propan-2-ylpyridine-2,3-diamine.
| Compound Name | 6-methoxy-2-N-propan-2-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 115320271 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 6-methoxy-2-N-propan-2-ylpyridine-2,3-diamine |
| SMILES | COc1ccc(N)c(NC(C)C)n1 |
| InChI | InChI=1S/C9H15N3O/c1-6(2)11-9-7(10)4-5-8(12-9)13-3/h4-6H,10H2,1-3H3,(H,11,12) |
| InChIKey | LUPFTJLRQCGURZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |